C7H3ClF3NaO3S — CID 50998749
sodium 2-chloro-5-(trifluoromethyl)benzenesulfonate (PubChem CID 50998749) has the molecular formula C7H3ClF3NaO3S and a molecular weight of 282.60 g/mol. Its IUPAC name is sodium 2-chloro-5-(trifluoromethyl)benzenesulfonate.
| Compound Name | sodium 2-chloro-5-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 50998749 |
| Molecular Formula | C7H3ClF3NaO3S |
| Molecular Weight | 282.60 g/mol |
| Exact Mass | 281.93 |
| IUPAC Name | sodium 2-chloro-5-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1cc(C(F)(F)F)ccc1Cl.[Na+] |
| InChI | InChI=1S/C7H4ClF3O3S.Na/c8-5-2-1-4(7(9,10)11)3-6(5)15(12,13)14;/h1-3H,(H,12,13,14);/q;+1/p-1 |
| InChIKey | NMDJKIXTABFYSQ-UHFFFAOYSA-M |
| XLogP | -0.73 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.60 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|