C10H9ClF3NO3S — CID 63105321
1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylazetidin-3-ol (PubChem CID 63105321) has the molecular formula C10H9ClF3NO3S and a molecular weight of 315.70 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylazetidin-3-ol.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylazetidin-3-ol |
|---|---|
| PubChem CID | 63105321 |
| Molecular Formula | C10H9ClF3NO3S |
| Molecular Weight | 315.70 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylazetidin-3-ol |
| SMILES | O=S(=O)(c1cc(C(F)(F)F)ccc1Cl)N1CC(O)C1 |
| InChI | InChI=1S/C10H9ClF3NO3S/c11-8-2-1-6(10(12,13)14)3-9(8)19(17,18)15-4-7(16)5-15/h1-3,7,16H,4-5H2 |
| InChIKey | HPROANBWHOFOJX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.70 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |