C11H13Cl2F3N2O2S — CID 119962428
(3R)-1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 119962428) has the molecular formula C11H13Cl2F3N2O2S and a molecular weight of 365.20 g/mol. Its IUPAC name is (3R)-1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | (3R)-1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119962428 |
| Molecular Formula | C11H13Cl2F3N2O2S |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | (3R)-1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(S(=O)(=O)c2cc(C(F)(F)F)ccc2Cl)C1 |
| InChI | InChI=1S/C11H12ClF3N2O2S.ClH/c12-9-2-1-7(11(13,14)15)5-10(9)20(18,19)17-4-3-8(16)6-17;/h1-2,5,8H,3-4,6,16H2;1H/t8-;/m1./s1 |
| InChIKey | BXNTUJOUJIWIRV-DDWIOCJRSA-N |
| XLogP | 2.50 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |