C18H19ClF3NO2S — CID 174517761
1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-4-cyclohexa-2,5-dien-1-ylpiperidine (PubChem CID 174517761) has the molecular formula C18H19ClF3NO2S and a molecular weight of 405.87 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-4-cyclohexa-2,5-dien-1-ylpiperidine.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-4-cyclohexa-2,5-dien-1-ylpiperidine |
|---|---|
| PubChem CID | 174517761 |
| Molecular Formula | C18H19ClF3NO2S |
| Molecular Weight | 405.87 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-4-cyclohexa-2,5-dien-1-ylpiperidine |
| SMILES | O=S(=O)(c1cc(C(F)(F)F)ccc1Cl)N1CCC(C2C=CCC=C2)CC1 |
| InChI | InChI=1S/C18H19ClF3NO2S/c19-16-7-6-15(18(20,21)22)12-17(16)26(24,25)23-10-8-14(9-11-23)13-4-2-1-3-5-13/h2-7,12-14H,1,8-11H2 |
| InChIKey | LKFVLZVLEOJQGB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.87 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|