C17H21ClF3N3O3S — CID 24622280
[4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-piperidin-1-ylmethanone (PubChem CID 24622280) has the molecular formula C17H21ClF3N3O3S and a molecular weight of 439.89 g/mol. Its IUPAC name is [4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-piperidin-1-ylmethanone.
| Compound Name | [4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 24622280 |
| Molecular Formula | C17H21ClF3N3O3S |
| Molecular Weight | 439.89 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | [4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(N1CCCCC1)N1CCN(S(=O)(=O)c2cc(C(F)(F)F)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H21ClF3N3O3S/c18-14-5-4-13(17(19,20)21)12-15(14)28(26,27)24-10-8-23(9-11-24)16(25)22-6-2-1-3-7-22/h4-5,12H,1-3,6-11H2 |
| InChIKey | OXYLLPDZUPFTKD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.89 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |