C16H14ClF3N2O4S — CID 27020023
[4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-(furan-3-yl)methanone (PubChem CID 27020023) has the molecular formula C16H14ClF3N2O4S and a molecular weight of 422.81 g/mol. Its IUPAC name is [4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-(furan-3-yl)methanone.
| Compound Name | [4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 27020023 |
| Molecular Formula | C16H14ClF3N2O4S |
| Molecular Weight | 422.81 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | [4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-(furan-3-yl)methanone |
| SMILES | O=C(c1ccoc1)N1CCN(S(=O)(=O)c2cc(C(F)(F)F)ccc2Cl)CC1 |
| InChI | InChI=1S/C16H14ClF3N2O4S/c17-13-2-1-12(16(18,19)20)9-14(13)27(24,25)22-6-4-21(5-7-22)15(23)11-3-8-26-10-11/h1-3,8-10H,4-7H2 |
| InChIKey | DBKBGWWWTMBNLM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.81 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |