C16H14Cl2N2O3 — CID 32530613
(3,4-dichlorophenyl)-[4-(furan-3-carbonyl)piperazin-1-yl]methanone (PubChem CID 32530613) has the molecular formula C16H14Cl2N2O3 and a molecular weight of 353.20 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[4-(furan-3-carbonyl)piperazin-1-yl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[4-(furan-3-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 32530613 |
| Molecular Formula | C16H14Cl2N2O3 |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | (3,4-dichlorophenyl)-[4-(furan-3-carbonyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccoc1)N1CCN(C(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H14Cl2N2O3/c17-13-2-1-11(9-14(13)18)15(21)19-4-6-20(7-5-19)16(22)12-3-8-23-10-12/h1-3,8-10H,4-7H2 |
| InChIKey | ZSSWTQWZRWZGJX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |