C13H14Cl2N2O2 — CID 78783392
1-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]ethanone (PubChem CID 78783392) has the molecular formula C13H14Cl2N2O2 and a molecular weight of 301.17 g/mol. Its IUPAC name is 1-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 78783392 |
| Molecular Formula | C13H14Cl2N2O2 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 1-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H14Cl2N2O2/c1-9(18)16-4-6-17(7-5-16)13(19)10-2-3-11(14)12(15)8-10/h2-3,8H,4-7H2,1H3 |
| InChIKey | MTPMDDSNMFUKKK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |