C18H15Cl3N2O2 — CID 39711919
[4-(2-chlorobenzoyl)piperazin-1-yl]-(3,4-dichlorophenyl)methanone (PubChem CID 39711919) has the molecular formula C18H15Cl3N2O2 and a molecular weight of 397.69 g/mol. Its IUPAC name is [4-(2-chlorobenzoyl)piperazin-1-yl]-(3,4-dichlorophenyl)methanone.
| Compound Name | [4-(2-chlorobenzoyl)piperazin-1-yl]-(3,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 39711919 |
| Molecular Formula | C18H15Cl3N2O2 |
| Molecular Weight | 397.69 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | [4-(2-chlorobenzoyl)piperazin-1-yl]-(3,4-dichlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)N1CCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H15Cl3N2O2/c19-14-4-2-1-3-13(14)18(25)23-9-7-22(8-10-23)17(24)12-5-6-15(20)16(21)11-12/h1-6,11H,7-10H2 |
| InChIKey | XJNAXRATWRIJOL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.69 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |