C13H16Cl2N2O — CID 17163669
(3,4-dichlorophenyl)-(4-methyl-1,4-diazepan-1-yl)methanone (PubChem CID 17163669) has the molecular formula C13H16Cl2N2O and a molecular weight of 287.19 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(4-methyl-1,4-diazepan-1-yl)methanone.
| Compound Name | (3,4-dichlorophenyl)-(4-methyl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 17163669 |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | (3,4-dichlorophenyl)-(4-methyl-1,4-diazepan-1-yl)methanone |
| SMILES | CN1CCCN(C(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H16Cl2N2O/c1-16-5-2-6-17(8-7-16)13(18)10-3-4-11(14)12(15)9-10/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | KMGHZWAWJBAZRW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |