C19H24Cl2N2O2 — CID 108543908
cyclohexyl-[4-(3,4-dichlorobenzoyl)-1,4-diazepan-1-yl]methanone (PubChem CID 108543908) has the molecular formula C19H24Cl2N2O2 and a molecular weight of 383.32 g/mol. Its IUPAC name is cyclohexyl-[4-(3,4-dichlorobenzoyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | cyclohexyl-[4-(3,4-dichlorobenzoyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 108543908 |
| Molecular Formula | C19H24Cl2N2O2 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | cyclohexyl-[4-(3,4-dichlorobenzoyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)N1CCCN(C(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C19H24Cl2N2O2/c20-16-8-7-15(13-17(16)21)19(25)23-10-4-9-22(11-12-23)18(24)14-5-2-1-3-6-14/h7-8,13-14H,1-6,9-12H2 |
| InChIKey | ZMNMTTXWAKXFOC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |