C19H26N2O4 — CID 108544690
cyclohexyl-[4-(3,5-dihydroxybenzoyl)-1,4-diazepan-1-yl]methanone (PubChem CID 108544690) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is cyclohexyl-[4-(3,5-dihydroxybenzoyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | cyclohexyl-[4-(3,5-dihydroxybenzoyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 108544690 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | cyclohexyl-[4-(3,5-dihydroxybenzoyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1cc(O)cc(O)c1)N1CCCN(C(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C19H26N2O4/c22-16-11-15(12-17(23)13-16)19(25)21-8-4-7-20(9-10-21)18(24)14-5-2-1-3-6-14/h11-14,22-23H,1-10H2 |
| InChIKey | ILUOCIAVIPHOFM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |