C18H27N3O2 — CID 137336165
cycloheptyl-[4-(1H-pyrrole-3-carbonyl)-1,4-diazepan-1-yl]methanone (PubChem CID 137336165) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is cycloheptyl-[4-(1H-pyrrole-3-carbonyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | cycloheptyl-[4-(1H-pyrrole-3-carbonyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 137336165 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | cycloheptyl-[4-(1H-pyrrole-3-carbonyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1cc[nH]c1)N1CCCN(C(=O)C2CCCCCC2)CC1 |
| InChI | InChI=1S/C18H27N3O2/c22-17(15-6-3-1-2-4-7-15)20-10-5-11-21(13-12-20)18(23)16-8-9-19-14-16/h8-9,14-15,19H,1-7,10-13H2 |
| InChIKey | FKJWITAAEXRFDG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |