C11H16N2O — CID 110691126
azepan-1-yl(1H-pyrrol-3-yl)methanone (PubChem CID 110691126) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is azepan-1-yl(1H-pyrrol-3-yl)methanone.
| Compound Name | azepan-1-yl(1H-pyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 110691126 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | azepan-1-yl(1H-pyrrol-3-yl)methanone |
| SMILES | O=C(c1cc[nH]c1)N1CCCCCC1 |
| InChI | InChI=1S/C11H16N2O/c14-11(10-5-6-12-9-10)13-7-3-1-2-4-8-13/h5-6,9,12H,1-4,7-8H2 |
| InChIKey | WCQCLNVWKFUHDF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |