C21H29N3O2 — CID 110809208
[4-(adamantane-1-carbonyl)-1,4-diazepan-1-yl]-(1H-pyrrol-3-yl)methanone (PubChem CID 110809208) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is [4-(adamantane-1-carbonyl)-1,4-diazepan-1-yl]-(1H-pyrrol-3-yl)methanone.
| Compound Name | [4-(adamantane-1-carbonyl)-1,4-diazepan-1-yl]-(1H-pyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 110809208 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | [4-(adamantane-1-carbonyl)-1,4-diazepan-1-yl]-(1H-pyrrol-3-yl)methanone |
| SMILES | O=C(c1cc[nH]c1)N1CCCN(C(=O)C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C21H29N3O2/c25-19(18-2-3-22-14-18)23-4-1-5-24(7-6-23)20(26)21-11-15-8-16(12-21)10-17(9-15)13-21/h2-3,14-17,22H,1,4-13H2 |
| InChIKey | ADVLJNLHULZDEG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |