C17H16F3N3O2 — CID 110808668
1H-pyrrol-3-yl-[4-(2,3,4-trifluorobenzoyl)-1,4-diazepan-1-yl]methanone (PubChem CID 110808668) has the molecular formula C17H16F3N3O2 and a molecular weight of 351.33 g/mol. Its IUPAC name is 1H-pyrrol-3-yl-[4-(2,3,4-trifluorobenzoyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | 1H-pyrrol-3-yl-[4-(2,3,4-trifluorobenzoyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 110808668 |
| Molecular Formula | C17H16F3N3O2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 1H-pyrrol-3-yl-[4-(2,3,4-trifluorobenzoyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1cc[nH]c1)N1CCCN(C(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C17H16F3N3O2/c18-13-3-2-12(14(19)15(13)20)17(25)23-7-1-6-22(8-9-23)16(24)11-4-5-21-10-11/h2-5,10,21H,1,6-9H2 |
| InChIKey | MDCFWDCVIWWZEL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|