C23H20F3N3O2 — CID 108547486
(4-pyrrol-1-ylphenyl)-[4-(2,3,4-trifluorobenzoyl)-1,4-diazepan-1-yl]methanone (PubChem CID 108547486) has the molecular formula C23H20F3N3O2 and a molecular weight of 427.43 g/mol. Its IUPAC name is (4-pyrrol-1-ylphenyl)-[4-(2,3,4-trifluorobenzoyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (4-pyrrol-1-ylphenyl)-[4-(2,3,4-trifluorobenzoyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 108547486 |
| Molecular Formula | C23H20F3N3O2 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | (4-pyrrol-1-ylphenyl)-[4-(2,3,4-trifluorobenzoyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1ccc(-n2cccc2)cc1)N1CCCN(C(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C23H20F3N3O2/c24-19-9-8-18(20(25)21(19)26)23(31)29-13-3-12-28(14-15-29)22(30)16-4-6-17(7-5-16)27-10-1-2-11-27/h1-2,4-11H,3,12-15H2 |
| InChIKey | ZKISZXCXVNLVBQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|