C18H23N3O3S — CID 110810041
(4-ethylsulfonyl-1,4-diazepan-1-yl)-(4-pyrrol-1-ylphenyl)methanone (PubChem CID 110810041) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is (4-ethylsulfonyl-1,4-diazepan-1-yl)-(4-pyrrol-1-ylphenyl)methanone.
| Compound Name | (4-ethylsulfonyl-1,4-diazepan-1-yl)-(4-pyrrol-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 110810041 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (4-ethylsulfonyl-1,4-diazepan-1-yl)-(4-pyrrol-1-ylphenyl)methanone |
| SMILES | CCS(=O)(=O)N1CCCN(C(=O)c2ccc(-n3cccc3)cc2)CC1 |
| InChI | InChI=1S/C18H23N3O3S/c1-2-25(23,24)21-13-5-12-20(14-15-21)18(22)16-6-8-17(9-7-16)19-10-3-4-11-19/h3-4,6-11H,2,5,12-15H2,1H3 |
| InChIKey | WMOVKEXTWUIGQO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |