C12H18N2O4S — CID 53016384
(4-ethylsulfonyl-1,4-diazepan-1-yl)-(furan-3-yl)methanone (PubChem CID 53016384) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is (4-ethylsulfonyl-1,4-diazepan-1-yl)-(furan-3-yl)methanone.
| Compound Name | (4-ethylsulfonyl-1,4-diazepan-1-yl)-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 53016384 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (4-ethylsulfonyl-1,4-diazepan-1-yl)-(furan-3-yl)methanone |
| SMILES | CCS(=O)(=O)N1CCCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C12H18N2O4S/c1-2-19(16,17)14-6-3-5-13(7-8-14)12(15)11-4-9-18-10-11/h4,9-10H,2-3,5-8H2,1H3 |
| InChIKey | DWQZYNIXRMNKJY-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |