C15H22N2O5S — CID 102555700
furan-3-yl-[4-(oxan-2-ylmethylsulfonyl)piperazin-1-yl]methanone (PubChem CID 102555700) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is furan-3-yl-[4-(oxan-2-ylmethylsulfonyl)piperazin-1-yl]methanone.
| Compound Name | furan-3-yl-[4-(oxan-2-ylmethylsulfonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 102555700 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | furan-3-yl-[4-(oxan-2-ylmethylsulfonyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccoc1)N1CCN(S(=O)(=O)CC2CCCCO2)CC1 |
| InChI | InChI=1S/C15H22N2O5S/c18-15(13-4-10-21-11-13)16-5-7-17(8-6-16)23(19,20)12-14-3-1-2-9-22-14/h4,10-11,14H,1-3,5-9,12H2 |
| InChIKey | OIHFBXSQWYMMDU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |