C24H25N3O2 — CID 108545585
2-phenyl-1-[4-(4-pyrrol-1-ylbenzoyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 108545585) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-phenyl-1-[4-(4-pyrrol-1-ylbenzoyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-phenyl-1-[4-(4-pyrrol-1-ylbenzoyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 108545585 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 2-phenyl-1-[4-(4-pyrrol-1-ylbenzoyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | O=C(Cc1ccccc1)N1CCCN(C(=O)c2ccc(-n3cccc3)cc2)CC1 |
| InChI | InChI=1S/C24H25N3O2/c28-23(19-20-7-2-1-3-8-20)26-15-6-16-27(18-17-26)24(29)21-9-11-22(12-10-21)25-13-4-5-14-25/h1-5,7-14H,6,15-19H2 |
| InChIKey | NRTXJLJGWGKCFF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |