C22H26N2O3 — CID 110808271
1-[4-(4-ethoxybenzoyl)-1,4-diazepan-1-yl]-2-phenylethanone (PubChem CID 110808271) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-[4-(4-ethoxybenzoyl)-1,4-diazepan-1-yl]-2-phenylethanone.
| Compound Name | 1-[4-(4-ethoxybenzoyl)-1,4-diazepan-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 110808271 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-[4-(4-ethoxybenzoyl)-1,4-diazepan-1-yl]-2-phenylethanone |
| SMILES | CCOc1ccc(C(=O)N2CCCN(C(=O)Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H26N2O3/c1-2-27-20-11-9-19(10-12-20)22(26)24-14-6-13-23(15-16-24)21(25)17-18-7-4-3-5-8-18/h3-5,7-12H,2,6,13-17H2,1H3 |
| InChIKey | TZYLBYKUMKTHAW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |