C20H25N3O3 — CID 110816661
1-[4-(4-ethoxybenzoyl)-1,4-diazepan-1-yl]-2-(1H-pyrrol-3-yl)ethanone (PubChem CID 110816661) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-[4-(4-ethoxybenzoyl)-1,4-diazepan-1-yl]-2-(1H-pyrrol-3-yl)ethanone.
| Compound Name | 1-[4-(4-ethoxybenzoyl)-1,4-diazepan-1-yl]-2-(1H-pyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 110816661 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 1-[4-(4-ethoxybenzoyl)-1,4-diazepan-1-yl]-2-(1H-pyrrol-3-yl)ethanone |
| SMILES | CCOc1ccc(C(=O)N2CCCN(C(=O)Cc3cc[nH]c3)CC2)cc1 |
| InChI | InChI=1S/C20H25N3O3/c1-2-26-18-6-4-17(5-7-18)20(25)23-11-3-10-22(12-13-23)19(24)14-16-8-9-21-15-16/h4-9,15,21H,2-3,10-14H2,1H3 |
| InChIKey | JWHXKXNBUZKWRZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |