C19H22FN3O3 — CID 110815288
1-[4-(4-ethoxy-3-fluorobenzoyl)piperazin-1-yl]-2-(1H-pyrrol-3-yl)ethanone (PubChem CID 110815288) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is 1-[4-(4-ethoxy-3-fluorobenzoyl)piperazin-1-yl]-2-(1H-pyrrol-3-yl)ethanone.
| Compound Name | 1-[4-(4-ethoxy-3-fluorobenzoyl)piperazin-1-yl]-2-(1H-pyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 110815288 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 1-[4-(4-ethoxy-3-fluorobenzoyl)piperazin-1-yl]-2-(1H-pyrrol-3-yl)ethanone |
| SMILES | CCOc1ccc(C(=O)N2CCN(C(=O)Cc3cc[nH]c3)CC2)cc1F |
| InChI | InChI=1S/C19H22FN3O3/c1-2-26-17-4-3-15(12-16(17)20)19(25)23-9-7-22(8-10-23)18(24)11-14-5-6-21-13-14/h3-6,12-13,21H,2,7-11H2,1H3 |
| InChIKey | JTXNKGDHCSKBSK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |