C25H38N2O5 — CID 108544633
cyclohexyl-[4-(3,4,5-triethoxybenzoyl)-1,4-diazepan-1-yl]methanone (PubChem CID 108544633) has the molecular formula C25H38N2O5 and a molecular weight of 446.59 g/mol. Its IUPAC name is cyclohexyl-[4-(3,4,5-triethoxybenzoyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | cyclohexyl-[4-(3,4,5-triethoxybenzoyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 108544633 |
| Molecular Formula | C25H38N2O5 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | cyclohexyl-[4-(3,4,5-triethoxybenzoyl)-1,4-diazepan-1-yl]methanone |
| SMILES | CCOc1cc(C(=O)N2CCCN(C(=O)C3CCCCC3)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H38N2O5/c1-4-30-21-17-20(18-22(31-5-2)23(21)32-6-3)25(29)27-14-10-13-26(15-16-27)24(28)19-11-8-7-9-12-19/h17-19H,4-16H2,1-3H3 |
| InChIKey | YNBHPTPZYXPQJW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |