C20H27FN2O3 — CID 110807508
cyclopentyl-[4-(4-ethoxy-3-fluorobenzoyl)-1,4-diazepan-1-yl]methanone (PubChem CID 110807508) has the molecular formula C20H27FN2O3 and a molecular weight of 362.45 g/mol. Its IUPAC name is cyclopentyl-[4-(4-ethoxy-3-fluorobenzoyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | cyclopentyl-[4-(4-ethoxy-3-fluorobenzoyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 110807508 |
| Molecular Formula | C20H27FN2O3 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | cyclopentyl-[4-(4-ethoxy-3-fluorobenzoyl)-1,4-diazepan-1-yl]methanone |
| SMILES | CCOc1ccc(C(=O)N2CCCN(C(=O)C3CCCC3)CC2)cc1F |
| InChI | InChI=1S/C20H27FN2O3/c1-2-26-18-9-8-16(14-17(18)21)20(25)23-11-5-10-22(12-13-23)19(24)15-6-3-4-7-15/h8-9,14-15H,2-7,10-13H2,1H3 |
| InChIKey | FZUQPPLRZOWOKH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |