C19H29NO5 — CID 110294879
[3-(hydroxymethyl)piperidin-1-yl]-(3,4,5-triethoxyphenyl)methanone (PubChem CID 110294879) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is [3-(hydroxymethyl)piperidin-1-yl]-(3,4,5-triethoxyphenyl)methanone.
| Compound Name | [3-(hydroxymethyl)piperidin-1-yl]-(3,4,5-triethoxyphenyl)methanone |
|---|---|
| PubChem CID | 110294879 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | [3-(hydroxymethyl)piperidin-1-yl]-(3,4,5-triethoxyphenyl)methanone |
| SMILES | CCOc1cc(C(=O)N2CCCC(CO)C2)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H29NO5/c1-4-23-16-10-15(11-17(24-5-2)18(16)25-6-3)19(22)20-9-7-8-14(12-20)13-21/h10-11,14,21H,4-9,12-13H2,1-3H3 |
| InChIKey | HEHRUKBTJZBGMJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |