C22H29N3O5 — CID 122259783
(3-pyrimidin-4-yloxypiperidin-1-yl)-(3,4,5-triethoxyphenyl)methanone (PubChem CID 122259783) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is (3-pyrimidin-4-yloxypiperidin-1-yl)-(3,4,5-triethoxyphenyl)methanone.
| Compound Name | (3-pyrimidin-4-yloxypiperidin-1-yl)-(3,4,5-triethoxyphenyl)methanone |
|---|---|
| PubChem CID | 122259783 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (3-pyrimidin-4-yloxypiperidin-1-yl)-(3,4,5-triethoxyphenyl)methanone |
| SMILES | CCOc1cc(C(=O)N2CCCC(Oc3ccncn3)C2)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H29N3O5/c1-4-27-18-12-16(13-19(28-5-2)21(18)29-6-3)22(26)25-11-7-8-17(14-25)30-20-9-10-23-15-24-20/h9-10,12-13,15,17H,4-8,11,14H2,1-3H3 |
| InChIKey | IJFAPJWYIIWIQV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 83.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |