C19H18Cl2N2O5 — CID 108543920
(3,4-dichlorophenyl)-[4-(3,4,5-trihydroxybenzoyl)-1,4-diazepan-1-yl]methanone (PubChem CID 108543920) has the molecular formula C19H18Cl2N2O5 and a molecular weight of 425.27 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[4-(3,4,5-trihydroxybenzoyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[4-(3,4,5-trihydroxybenzoyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 108543920 |
| Molecular Formula | C19H18Cl2N2O5 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | (3,4-dichlorophenyl)-[4-(3,4,5-trihydroxybenzoyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1cc(O)c(O)c(O)c1)N1CCCN(C(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H18Cl2N2O5/c20-13-3-2-11(8-14(13)21)18(27)22-4-1-5-23(7-6-22)19(28)12-9-15(24)17(26)16(25)10-12/h2-3,8-10,24-26H,1,4-7H2 |
| InChIKey | WGNOJLRUXWUPRT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|