C18H17ClFN3O2 — CID 110808597
[4-(3-chloro-4-fluorobenzoyl)-1,4-diazepan-1-yl]-pyridin-4-ylmethanone (PubChem CID 110808597) has the molecular formula C18H17ClFN3O2 and a molecular weight of 361.80 g/mol. Its IUPAC name is [4-(3-chloro-4-fluorobenzoyl)-1,4-diazepan-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [4-(3-chloro-4-fluorobenzoyl)-1,4-diazepan-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 110808597 |
| Molecular Formula | C18H17ClFN3O2 |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [4-(3-chloro-4-fluorobenzoyl)-1,4-diazepan-1-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1CCCN(C(=O)c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H17ClFN3O2/c19-15-12-14(2-3-16(15)20)18(25)23-9-1-8-22(10-11-23)17(24)13-4-6-21-7-5-13/h2-7,12H,1,8-11H2 |
| InChIKey | MKAIFSLIJCFDHV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |