C15H18Cl2N2O3 — CID 108533555
1-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-3-methoxypropan-1-one (PubChem CID 108533555) has the molecular formula C15H18Cl2N2O3 and a molecular weight of 345.23 g/mol. Its IUPAC name is 1-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-3-methoxypropan-1-one.
| Compound Name | 1-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-3-methoxypropan-1-one |
|---|---|
| PubChem CID | 108533555 |
| Molecular Formula | C15H18Cl2N2O3 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-3-methoxypropan-1-one |
| SMILES | COCCC(=O)N1CCN(C(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H18Cl2N2O3/c1-22-9-4-14(20)18-5-7-19(8-6-18)15(21)11-2-3-12(16)13(17)10-11/h2-3,10H,4-9H2,1H3 |
| InChIKey | ZIBCHOSOPKLVAF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |