C21H22Cl2N2O3 — CID 108533558
1-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-2-(2-ethylphenoxy)ethanone (PubChem CID 108533558) has the molecular formula C21H22Cl2N2O3 and a molecular weight of 421.32 g/mol. Its IUPAC name is 1-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-2-(2-ethylphenoxy)ethanone.
| Compound Name | 1-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-2-(2-ethylphenoxy)ethanone |
|---|---|
| PubChem CID | 108533558 |
| Molecular Formula | C21H22Cl2N2O3 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 1-[4-(3,4-dichlorobenzoyl)piperazin-1-yl]-2-(2-ethylphenoxy)ethanone |
| SMILES | CCc1ccccc1OCC(=O)N1CCN(C(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C21H22Cl2N2O3/c1-2-15-5-3-4-6-19(15)28-14-20(26)24-9-11-25(12-10-24)21(27)16-7-8-17(22)18(23)13-16/h3-8,13H,2,9-12,14H2,1H3 |
| InChIKey | KZVKTZYJCRBGGU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |