C16H13Cl2FN2O3 — CID 32532621
[4-(2,4-dichloro-5-fluorobenzoyl)piperazin-1-yl]-(furan-3-yl)methanone (PubChem CID 32532621) has the molecular formula C16H13Cl2FN2O3 and a molecular weight of 371.20 g/mol. Its IUPAC name is [4-(2,4-dichloro-5-fluorobenzoyl)piperazin-1-yl]-(furan-3-yl)methanone.
| Compound Name | [4-(2,4-dichloro-5-fluorobenzoyl)piperazin-1-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 32532621 |
| Molecular Formula | C16H13Cl2FN2O3 |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | [4-(2,4-dichloro-5-fluorobenzoyl)piperazin-1-yl]-(furan-3-yl)methanone |
| SMILES | O=C(c1ccoc1)N1CCN(C(=O)c2cc(F)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C16H13Cl2FN2O3/c17-12-8-13(18)14(19)7-11(12)16(23)21-4-2-20(3-5-21)15(22)10-1-6-24-9-10/h1,6-9H,2-5H2 |
| InChIKey | SYLVARATPJWVID-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|