C20H19ClF2N2O4 — CID 34477784
[4-(2-chloro-4,5-difluorobenzoyl)piperazin-1-yl]-(3,4-dimethoxyphenyl)methanone (PubChem CID 34477784) has the molecular formula C20H19ClF2N2O4 and a molecular weight of 424.83 g/mol. Its IUPAC name is [4-(2-chloro-4,5-difluorobenzoyl)piperazin-1-yl]-(3,4-dimethoxyphenyl)methanone.
| Compound Name | [4-(2-chloro-4,5-difluorobenzoyl)piperazin-1-yl]-(3,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 34477784 |
| Molecular Formula | C20H19ClF2N2O4 |
| Molecular Weight | 424.83 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | [4-(2-chloro-4,5-difluorobenzoyl)piperazin-1-yl]-(3,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCN(C(=O)c3cc(F)c(F)cc3Cl)CC2)cc1OC |
| InChI | InChI=1S/C20H19ClF2N2O4/c1-28-17-4-3-12(9-18(17)29-2)19(26)24-5-7-25(8-6-24)20(27)13-10-15(22)16(23)11-14(13)21/h3-4,9-11H,5-8H2,1-2H3 |
| InChIKey | HENDFCNJZPNOOG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.83 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|