C16H19ClF3N3O4S — CID 24603010
[4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-morpholin-4-ylmethanone (PubChem CID 24603010) has the molecular formula C16H19ClF3N3O4S and a molecular weight of 441.86 g/mol. Its IUPAC name is [4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 24603010 |
| Molecular Formula | C16H19ClF3N3O4S |
| Molecular Weight | 441.86 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | [4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(N1CCOCC1)N1CCN(S(=O)(=O)c2cc(C(F)(F)F)ccc2Cl)CC1 |
| InChI | InChI=1S/C16H19ClF3N3O4S/c17-13-2-1-12(16(18,19)20)11-14(13)28(25,26)23-5-3-21(4-6-23)15(24)22-7-9-27-10-8-22/h1-2,11H,3-10H2 |
| InChIKey | HAPRHTZAROQTBG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.86 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |