C7H3F4O3S- — CID 22057394
2-fluoro-4-(trifluoromethyl)benzenesulfonate (PubChem CID 22057394) has the molecular formula C7H3F4O3S- and a molecular weight of 243.16 g/mol. Its IUPAC name is 2-fluoro-4-(trifluoromethyl)benzenesulfonate.
| Compound Name | 2-fluoro-4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 22057394 |
| Molecular Formula | C7H3F4O3S- |
| Molecular Weight | 243.16 g/mol |
| Exact Mass | 242.97 |
| IUPAC Name | 2-fluoro-4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C7H4F4O3S/c8-5-3-4(7(9,10)11)1-2-6(5)15(12,13)14/h1-3H,(H,12,13,14)/p-1 |
| InChIKey | BPPQODIYRMBPAA-UHFFFAOYSA-M |
| XLogP | 1.75 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.16 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|