C11H8F3O5S- — CID 102393226
2-(2-methylprop-2-enoyloxy)-4-(trifluoromethyl)benzenesulfonate (PubChem CID 102393226) has the molecular formula C11H8F3O5S- and a molecular weight of 309.24 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)-4-(trifluoromethyl)benzenesulfonate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)-4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 102393226 |
| Molecular Formula | C11H8F3O5S- |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)-4-(trifluoromethyl)benzenesulfonate |
| SMILES | C=C(C)C(=O)Oc1cc(C(F)(F)F)ccc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C11H9F3O5S/c1-6(2)10(15)19-8-5-7(11(12,13)14)3-4-9(8)20(16,17)18/h3-5H,1H2,2H3,(H,16,17,18)/p-1 |
| InChIKey | JYWUFVFIBFSDGB-UHFFFAOYSA-M |
| XLogP | 2.09 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|