C10H9NaO5S — CID 23690021
sodium 2-(2-methylprop-2-enoyloxy)benzenesulfonate (PubChem CID 23690021) has the molecular formula C10H9NaO5S and a molecular weight of 264.23 g/mol. Its IUPAC name is sodium 2-(2-methylprop-2-enoyloxy)benzenesulfonate.
| Compound Name | sodium 2-(2-methylprop-2-enoyloxy)benzenesulfonate |
|---|---|
| PubChem CID | 23690021 |
| Molecular Formula | C10H9NaO5S |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | sodium 2-(2-methylprop-2-enoyloxy)benzenesulfonate |
| SMILES | C=C(C)C(=O)Oc1ccccc1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H10O5S.Na/c1-7(2)10(11)15-8-5-3-4-6-9(8)16(12,13)14;/h3-6H,1H2,2H3,(H,12,13,14);/q;+1/p-1 |
| InChIKey | HHHFOFALLICHSO-UHFFFAOYSA-M |
| XLogP | -1.92 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|