C23H22O6S2 — CID 175695890
[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylsulfanium;methyl sulfate (PubChem CID 175695890) has the molecular formula C23H22O6S2 and a molecular weight of 458.56 g/mol. Its IUPAC name is [4-(2-methylprop-2-enoyloxy)phenyl]-diphenylsulfanium;methyl sulfate.
| Compound Name | [4-(2-methylprop-2-enoyloxy)phenyl]-diphenylsulfanium;methyl sulfate |
|---|---|
| PubChem CID | 175695890 |
| Molecular Formula | C23H22O6S2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | [4-(2-methylprop-2-enoyloxy)phenyl]-diphenylsulfanium;methyl sulfate |
| SMILES | C=C(C)C(=O)Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C22H19O2S.CH4O4S/c1-17(2)22(23)24-18-13-15-21(16-14-18)25(19-9-5-3-6-10-19)20-11-7-4-8-12-20;1-5-6(2,3)4/h3-16H,1H2,2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | AKZKXSOYQODKMH-UHFFFAOYSA-M |
| XLogP | 4.36 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|