C31H32F2O7S2 — CID 172791734
2-(cyclohexanecarbonyloxy)-1,1-difluoroethanesulfonate;[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylsulfanium (PubChem CID 172791734) has the molecular formula C31H32F2O7S2 and a molecular weight of 618.72 g/mol. Its IUPAC name is 2-(cyclohexanecarbonyloxy)-1,1-difluoroethanesulfonate;[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylsulfanium.
| Compound Name | 2-(cyclohexanecarbonyloxy)-1,1-difluoroethanesulfonate;[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 172791734 |
| Molecular Formula | C31H32F2O7S2 |
| Molecular Weight | 618.72 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | 2-(cyclohexanecarbonyloxy)-1,1-difluoroethanesulfonate;[4-(2-methylprop-2-enoyloxy)phenyl]-diphenylsulfanium |
| SMILES | C=C(C)C(=O)Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=C(OCC(F)(F)S(=O)(=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/C22H19O2S.C9H14F2O5S/c1-17(2)22(23)24-18-13-15-21(16-14-18)25(19-9-5-3-6-10-19)20-11-7-4-8-12-20;10-9(11,17(13,14)15)6-16-8(12)7-4-2-1-3-5-7/h3-16H,1H2,2H3;7H,1-6H2,(H,13,14,15)/q+1;/p-1 |
| InChIKey | PQTHRQJORFTBSS-UHFFFAOYSA-M |
| XLogP | 6.51 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.72 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|