C52H54O4S2+2 — CID 160996231
[4-(cyclohexanecarbonyloxy)-3,5-dimethylphenyl]-diphenylsulfanium;[4-(cyclohexanecarbonyloxy)phenyl]-diphenylsulfanium (PubChem CID 160996231) has the molecular formula C52H54O4S2+2 and a molecular weight of 807.13 g/mol. Its IUPAC name is [4-(cyclohexanecarbonyloxy)-3,5-dimethylphenyl]-diphenylsulfanium;[4-(cyclohexanecarbonyloxy)phenyl]-diphenylsulfanium.
| Compound Name | [4-(cyclohexanecarbonyloxy)-3,5-dimethylphenyl]-diphenylsulfanium;[4-(cyclohexanecarbonyloxy)phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 160996231 |
| Molecular Formula | C52H54O4S2+2 |
| Molecular Weight | 807.13 g/mol |
| Exact Mass | 806.35 |
| IUPAC Name | [4-(cyclohexanecarbonyloxy)-3,5-dimethylphenyl]-diphenylsulfanium;[4-(cyclohexanecarbonyloxy)phenyl]-diphenylsulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1OC(=O)C1CCCCC1.O=C(Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C27H29O2S.C25H25O2S/c1-20-18-25(19-21(2)26(20)29-27(28)22-12-6-3-7-13-22)30(23-14-8-4-9-15-23)24-16-10-5-11-17-24;26-25(20-10-4-1-5-11-20)27-21-16-18-24(19-17-21)28(22-12-6-2-7-13-22)23-14-8-3-9-15-23/h4-5,8-11,14-19,22H,3,6-7,12-13H2,1-2H3;2-3,6-9,12-20H,1,4-5,10-11H2/q2*+1 |
| InChIKey | TVGYMZSRXUBIGT-UHFFFAOYSA-N |
| XLogP | 13.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.13 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|