C26H32O6 — CID 19886717
[4-(cyclohexanecarbonyloxy)-2,3-dimethoxynaphthalen-1-yl] cyclohexanecarboxylate (PubChem CID 19886717) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is [4-(cyclohexanecarbonyloxy)-2,3-dimethoxynaphthalen-1-yl] cyclohexanecarboxylate.
| Compound Name | [4-(cyclohexanecarbonyloxy)-2,3-dimethoxynaphthalen-1-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 19886717 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [4-(cyclohexanecarbonyloxy)-2,3-dimethoxynaphthalen-1-yl] cyclohexanecarboxylate |
| SMILES | COc1c(OC)c(OC(=O)C2CCCCC2)c2ccccc2c1OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C26H32O6/c1-29-23-21(31-25(27)17-11-5-3-6-12-17)19-15-9-10-16-20(19)22(24(23)30-2)32-26(28)18-13-7-4-8-14-18/h9-10,15-18H,3-8,11-14H2,1-2H3 |
| InChIKey | OAJUKUFZWREQDF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|