C22H20O4 — CID 20998224
(4-oxo-2-phenylchromen-3-yl) cyclohexanecarboxylate (PubChem CID 20998224) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is (4-oxo-2-phenylchromen-3-yl) cyclohexanecarboxylate.
| Compound Name | (4-oxo-2-phenylchromen-3-yl) cyclohexanecarboxylate |
|---|---|
| PubChem CID | 20998224 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (4-oxo-2-phenylchromen-3-yl) cyclohexanecarboxylate |
| SMILES | O=C(Oc1c(-c2ccccc2)oc2ccccc2c1=O)C1CCCCC1 |
| InChI | InChI=1S/C22H20O4/c23-19-17-13-7-8-14-18(17)25-20(15-9-3-1-4-10-15)21(19)26-22(24)16-11-5-2-6-12-16/h1,3-4,7-10,13-14,16H,2,5-6,11-12H2 |
| InChIKey | NYHUNGAEXKMKMX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |