C23H21ClO5 — CID 7747103
[6-chloro-2-(4-methoxyphenyl)-4-oxochromen-3-yl] cyclohexanecarboxylate (PubChem CID 7747103) has the molecular formula C23H21ClO5 and a molecular weight of 412.87 g/mol. Its IUPAC name is [6-chloro-2-(4-methoxyphenyl)-4-oxochromen-3-yl] cyclohexanecarboxylate.
| Compound Name | [6-chloro-2-(4-methoxyphenyl)-4-oxochromen-3-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 7747103 |
| Molecular Formula | C23H21ClO5 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [6-chloro-2-(4-methoxyphenyl)-4-oxochromen-3-yl] cyclohexanecarboxylate |
| SMILES | COc1ccc(-c2oc3ccc(Cl)cc3c(=O)c2OC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H21ClO5/c1-27-17-10-7-14(8-11-17)21-22(29-23(26)15-5-3-2-4-6-15)20(25)18-13-16(24)9-12-19(18)28-21/h7-13,15H,2-6H2,1H3 |
| InChIKey | ZPOMTJKUBPXEBR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |