C24H24ClNO5 — CID 21000537
2-[6-chloro-2-(4-methoxyphenyl)-4-oxochromen-3-yl]oxy-N-cyclohexylacetamide (PubChem CID 21000537) has the molecular formula C24H24ClNO5 and a molecular weight of 441.91 g/mol. Its IUPAC name is 2-[6-chloro-2-(4-methoxyphenyl)-4-oxochromen-3-yl]oxy-N-cyclohexylacetamide.
| Compound Name | 2-[6-chloro-2-(4-methoxyphenyl)-4-oxochromen-3-yl]oxy-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 21000537 |
| Molecular Formula | C24H24ClNO5 |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-[6-chloro-2-(4-methoxyphenyl)-4-oxochromen-3-yl]oxy-N-cyclohexylacetamide |
| SMILES | COc1ccc(-c2oc3ccc(Cl)cc3c(=O)c2OCC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C24H24ClNO5/c1-29-18-10-7-15(8-11-18)23-24(22(28)19-13-16(25)9-12-20(19)31-23)30-14-21(27)26-17-5-3-2-4-6-17/h7-13,17H,2-6,14H2,1H3,(H,26,27) |
| InChIKey | DOUTZKLVMWEMCP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |