C22H15ClO6 — CID 7747145
[6-chloro-2-(furan-2-yl)-4-oxochromen-3-yl] 2-(4-methoxyphenyl)acetate (PubChem CID 7747145) has the molecular formula C22H15ClO6 and a molecular weight of 410.81 g/mol. Its IUPAC name is [6-chloro-2-(furan-2-yl)-4-oxochromen-3-yl] 2-(4-methoxyphenyl)acetate.
| Compound Name | [6-chloro-2-(furan-2-yl)-4-oxochromen-3-yl] 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 7747145 |
| Molecular Formula | C22H15ClO6 |
| Molecular Weight | 410.81 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | [6-chloro-2-(furan-2-yl)-4-oxochromen-3-yl] 2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)Oc2c(-c3ccco3)oc3ccc(Cl)cc3c2=O)cc1 |
| InChI | InChI=1S/C22H15ClO6/c1-26-15-7-4-13(5-8-15)11-19(24)29-22-20(25)16-12-14(23)6-9-17(16)28-21(22)18-3-2-10-27-18/h2-10,12H,11H2,1H3 |
| InChIKey | YLHAZHQZYDWPGI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.81 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |