C19H18ClNO5 — CID 21000703
N-butan-2-yl-2-[6-chloro-2-(furan-2-yl)-4-oxochromen-3-yl]oxyacetamide (PubChem CID 21000703) has the molecular formula C19H18ClNO5 and a molecular weight of 375.81 g/mol. Its IUPAC name is N-butan-2-yl-2-[6-chloro-2-(furan-2-yl)-4-oxochromen-3-yl]oxyacetamide.
| Compound Name | N-butan-2-yl-2-[6-chloro-2-(furan-2-yl)-4-oxochromen-3-yl]oxyacetamide |
|---|---|
| PubChem CID | 21000703 |
| Molecular Formula | C19H18ClNO5 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-butan-2-yl-2-[6-chloro-2-(furan-2-yl)-4-oxochromen-3-yl]oxyacetamide |
| SMILES | CCC(C)NC(=O)COc1c(-c2ccco2)oc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C19H18ClNO5/c1-3-11(2)21-16(22)10-25-19-17(23)13-9-12(20)6-7-14(13)26-18(19)15-5-4-8-24-15/h4-9,11H,3,10H2,1-2H3,(H,21,22) |
| InChIKey | WAABOMXWPFBXCO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |