C16H10ClO6- — CID 7747167
(2R)-2-[6-chloro-2-(furan-2-yl)-4-oxochromen-3-yl]oxypropanoate (PubChem CID 7747167) has the molecular formula C16H10ClO6- and a molecular weight of 333.70 g/mol. Its IUPAC name is (2R)-2-[6-chloro-2-(furan-2-yl)-4-oxochromen-3-yl]oxypropanoate.
| Compound Name | (2R)-2-[6-chloro-2-(furan-2-yl)-4-oxochromen-3-yl]oxypropanoate |
|---|---|
| PubChem CID | 7747167 |
| Molecular Formula | C16H10ClO6- |
| Molecular Weight | 333.70 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | (2R)-2-[6-chloro-2-(furan-2-yl)-4-oxochromen-3-yl]oxypropanoate |
| SMILES | C[C@@H](Oc1c(-c2ccco2)oc2ccc(Cl)cc2c1=O)C(=O)[O-] |
| InChI | InChI=1S/C16H11ClO6/c1-8(16(19)20)22-15-13(18)10-7-9(17)4-5-11(10)23-14(15)12-3-2-6-21-12/h2-8H,1H3,(H,19,20)/p-1/t8-/m1/s1 |
| InChIKey | BFHKXZGVJGAVKP-MRVPVSSYSA-M |
| XLogP | 2.22 |
| TPSA | 92.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.70 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |