C25H22ClNO6 — CID 21001500
2-[6-chloro-2-(furan-2-yl)-7-methyl-4-oxochromen-3-yl]oxy-N-(4-ethoxyphenyl)propanamide (PubChem CID 21001500) has the molecular formula C25H22ClNO6 and a molecular weight of 467.91 g/mol. Its IUPAC name is 2-[6-chloro-2-(furan-2-yl)-7-methyl-4-oxochromen-3-yl]oxy-N-(4-ethoxyphenyl)propanamide.
| Compound Name | 2-[6-chloro-2-(furan-2-yl)-7-methyl-4-oxochromen-3-yl]oxy-N-(4-ethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 21001500 |
| Molecular Formula | C25H22ClNO6 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-[6-chloro-2-(furan-2-yl)-7-methyl-4-oxochromen-3-yl]oxy-N-(4-ethoxyphenyl)propanamide |
| SMILES | CCOc1ccc(NC(=O)C(C)Oc2c(-c3ccco3)oc3cc(C)c(Cl)cc3c2=O)cc1 |
| InChI | InChI=1S/C25H22ClNO6/c1-4-30-17-9-7-16(8-10-17)27-25(29)15(3)32-24-22(28)18-13-19(26)14(2)12-21(18)33-23(24)20-6-5-11-31-20/h5-13,15H,4H2,1-3H3,(H,27,29) |
| InChIKey | TUXORDNROCHIDW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 90.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |