C25H21NO7 — CID 46303511
ethyl 4-[2-[2-(furan-2-yl)-4-oxochromen-3-yl]oxypropanoylamino]benzoate (PubChem CID 46303511) has the molecular formula C25H21NO7 and a molecular weight of 447.44 g/mol. Its IUPAC name is ethyl 4-[2-[2-(furan-2-yl)-4-oxochromen-3-yl]oxypropanoylamino]benzoate.
| Compound Name | ethyl 4-[2-[2-(furan-2-yl)-4-oxochromen-3-yl]oxypropanoylamino]benzoate |
|---|---|
| PubChem CID | 46303511 |
| Molecular Formula | C25H21NO7 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | ethyl 4-[2-[2-(furan-2-yl)-4-oxochromen-3-yl]oxypropanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(C)Oc2c(-c3ccco3)oc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C25H21NO7/c1-3-30-25(29)16-10-12-17(13-11-16)26-24(28)15(2)32-23-21(27)18-7-4-5-8-19(18)33-22(23)20-9-6-14-31-20/h4-15H,3H2,1-2H3,(H,26,28) |
| InChIKey | WHJQJOHVPQZWBJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 107.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |